Products 1154278-39-3
CAS 1154278-39-3 is the registry number for Methyl ((5-chloro-2-cyanophenyl)sulfonyl)glycinate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-[(5-chloro-2-cyanophenyl)sulfonylamino]acetate (CAS 1154278-39-3) is a chemical compound with the molecular formula C10H9ClN2O4S and a molecular weight of 288.71 g/mol. IUPAC name: methyl 2-[(5-chloro-2-cyanophenyl)sulfonylamino]acetate. InChIKey: XBXNCPPUAXVTMT-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O4S |
|---|---|
| Molecular weight | 288.71 g/mol |
| IUPAC name | methyl 2-[(5-chloro-2-cyanophenyl)sulfonylamino]acetate |
| InChIKey | XBXNCPPUAXVTMT-UHFFFAOYSA-N |
| SMILES | COC(=O)CNS(=O)(=O)C1=C(C=CC(=C1)Cl)C#N |
Computed by PubChem (NCBI)