CAS 88-76-6 appears in our catalog under these names: 1-(2'-Chloro-5'-sulfophenyl)-3-methyl-5-pyrazolone, 95%, 95%, 4-Chloro-3-(3-methyl-5-oxo-4,5-dihydro-1H-pyrazol-1-yl)benzenesulfonic acid. Offered by: Chemat, Fluorochem. Available pack sizes: 25g, 100g.
4-chloro-3-(3-methyl-5-oxo-4H-pyrazol-1-yl)benzenesulfonic acid (CAS 88-76-6) is a chemical compound with the molecular formula C10H9ClN2O4S and a molecular weight of 288.71 g/mol. IUPAC name: 4-chloro-3-(3-methyl-5-oxo-4H-pyrazol-1-yl)benzenesulfonic acid. InChIKey: UWLNKHDLVZEYKQ-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O4S |
|---|---|
| Molecular weight | 288.71 g/mol |
| IUPAC name | 4-chloro-3-(3-methyl-5-oxo-4H-pyrazol-1-yl)benzenesulfonic acid |
| InChIKey | UWLNKHDLVZEYKQ-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=O)C1)C2=C(C=CC(=C2)S(=O)(=O)O)Cl |
Computed by PubChem (NCBI)