CAS 1469764-14-4 is the registry number for 3-Ethyl-2,4-dioxo- 1,2,3,4-tetrahydroquinazoline-6-sulfonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
3-ethyl-2,4-dioxo-1H-quinazoline-6-sulfonyl chloride (CAS 1469764-14-4) is a chemical compound with the molecular formula C10H9ClN2O4S and a molecular weight of 288.71 g/mol. IUPAC name: 3-ethyl-2,4-dioxo-1H-quinazoline-6-sulfonyl chloride. InChIKey: PLBAYLCVSGYWBO-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O4S |
|---|---|
| Molecular weight | 288.71 g/mol |
| IUPAC name | 3-ethyl-2,4-dioxo-1H-quinazoline-6-sulfonyl chloride |
| InChIKey | PLBAYLCVSGYWBO-UHFFFAOYSA-N |
| SMILES | CCN1C(=O)C2=C(C=CC(=C2)S(=O)(=O)Cl)NC1=O |
Computed by PubChem (NCBI)