Products 1154334-87-8
CAS 1154334-87-8 is the registry number for 3-Chloro-6-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)pyridazine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-chloro-6-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)pyridazine (CAS 1154334-87-8) is a chemical compound with the molecular formula C13H11ClN2O2 and a molecular weight of 262.69 g/mol. IUPAC name: 3-chloro-6-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)pyridazine. InChIKey: PCZHNBRWOOSOCI-UHFFFAOYSA-N.
| Molecular formula | C13H11ClN2O2 |
|---|---|
| Molecular weight | 262.69 g/mol |
| IUPAC name | 3-chloro-6-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)pyridazine |
| InChIKey | PCZHNBRWOOSOCI-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C=C(C=C2)C3=NN=C(C=C3)Cl)OC1 |
Computed by PubChem (NCBI)