CAS 1154395-99-9 is the registry number for 4-(Ethenesulfonyl)-2-(trifluoromethyl)benzonitrile, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-ethenylsulfonyl-2-(trifluoromethyl)benzonitrile (CAS 1154395-99-9) is a chemical compound with the molecular formula C10H6F3NO2S and a molecular weight of 261.22 g/mol. IUPAC name: 4-ethenylsulfonyl-2-(trifluoromethyl)benzonitrile. InChIKey: GQUDCTVMIJTTOO-UHFFFAOYSA-N.
| Molecular formula | C10H6F3NO2S |
|---|---|
| Molecular weight | 261.22 g/mol |
| IUPAC name | 4-ethenylsulfonyl-2-(trifluoromethyl)benzonitrile |
| InChIKey | GQUDCTVMIJTTOO-UHFFFAOYSA-N |
| SMILES | C=CS(=O)(=O)C1=CC(=C(C=C1)C#N)C(F)(F)F |
Computed by PubChem (NCBI)