Products 1648807-88-8

CAS 1648807-88-8 is the registry number for 3-Amino-4-(trifluoromethyl)benzothiophene-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

3-amino-4-(trifluoromethyl)-1-benzothiophene-2-carboxylic acid (CAS 1648807-88-8) is a chemical compound with the molecular formula C10H6F3NO2S and a molecular weight of 261.22 g/mol. IUPAC name: 3-amino-4-(trifluoromethyl)-1-benzothiophene-2-carboxylic acid. InChIKey: HSRDUZIXWSRPGX-UHFFFAOYSA-N.

Identity
Molecular formulaC10H6F3NO2S
Molecular weight261.22 g/mol
IUPAC name3-amino-4-(trifluoromethyl)-1-benzothiophene-2-carboxylic acid
InChIKeyHSRDUZIXWSRPGX-UHFFFAOYSA-N
SMILESC1=CC(=C2C(=C1)SC(=C2N)C(=O)O)C(F)(F)F

Computed by PubChem (NCBI)