CAS 2682114-23-2 is the registry number for Methyl 2-(trifluoromethyl)benzo[d]thiazole-6-carboxylate, 97+%. Offered by: Ambeed. Available pack sizes: 100mg, 1g, 250mg.
Methyl 2-(trifluoromethyl)-1,3-benzothiazole-6-carboxylate (CAS 2682114-23-2) is a chemical compound with the molecular formula C10H6F3NO2S and a molecular weight of 261.22 g/mol. IUPAC name: methyl 2-(trifluoromethyl)-1,3-benzothiazole-6-carboxylate. InChIKey: MNRWJDXTDONPPN-UHFFFAOYSA-N.
| Molecular formula | C10H6F3NO2S |
|---|---|
| Molecular weight | 261.22 g/mol |
| IUPAC name | methyl 2-(trifluoromethyl)-1,3-benzothiazole-6-carboxylate |
| InChIKey | MNRWJDXTDONPPN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)N=C(S2)C(F)(F)F |
Computed by PubChem (NCBI)