Products 1154426-16-0
CAS 1154426-16-0 appears in our catalog under these names: Ethyl 2-fluoro-6-nitrobenzoate, 97%, Ethyl 2–Fluoro–6–nitrobenzoate, Ethyl 2-fluoro-6-nitrobenzoate 97+%, Ethyl 2-Fluoro-6-nitrobenzoate, 97%, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 100mg, 250mg, 10g.
Ethyl 2-fluoro-6-nitrobenzoate (CAS 1154426-16-0) is a chemical compound with the molecular formula C9H8FNO4 and a molecular weight of 213.16 g/mol. IUPAC name: ethyl 2-fluoro-6-nitrobenzoate. InChIKey: AQTBBISJVNTXEV-UHFFFAOYSA-N.
| Molecular formula | C9H8FNO4 |
|---|---|
| Molecular weight | 213.16 g/mol |
| IUPAC name | ethyl 2-fluoro-6-nitrobenzoate |
| InChIKey | AQTBBISJVNTXEV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC=C1F)[N+](=O)[O-] |
Computed by PubChem (NCBI)