CAS 115459-51-3 appears in our catalog under these names: (3R,4S,5R)-5-((Benzoyloxy)methyl)-3-hydroxytetrahydrofuran-2,4-diyl dibenzoate, 97%, (3R，4S，5R)–5–((benzoyloxy)methyl)–3–hydroxytetrahydrofuran–2，4–diyl dibenzoate. Offered by: AmBeed, GLPBio. Available pack sizes: 10g, 100mg, 1g, 250mg.
[(2R,3S,4R)-3,5-dibenzoyloxy-4-hydroxyoxolan-2-yl]methyl benzoate (CAS 115459-51-3) is a chemical compound with the molecular formula C26H22O8 and a molecular weight of 462.4 g/mol. IUPAC name: [(2R,3S,4R)-3,5-dibenzoyloxy-4-hydroxyoxolan-2-yl]methyl benzoate. InChIKey: HUHVPBKTTFVAQF-LLNWNZGGSA-N.
| Molecular formula | C26H22O8 |
|---|---|
| Molecular weight | 462.4 g/mol |
| IUPAC name | [(2R,3S,4R)-3,5-dibenzoyloxy-4-hydroxyoxolan-2-yl]methyl benzoate |
| InChIKey | HUHVPBKTTFVAQF-LLNWNZGGSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OC[C@@H]2[C@H]([C@H](C(O2)OC(=O)C3=CC=CC=C3)O)OC(=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)