CAS 98796-65-7 is the registry number for Clofarabine Impurity 11. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,3S,4R,5S)-3,5-dibenzoyloxy-4-hydroxyoxolan-2-yl]methyl benzoate (CAS 98796-65-7) is a chemical compound with the molecular formula C26H22O8 and a molecular weight of 462.4 g/mol. IUPAC name: [(2R,3S,4R,5S)-3,5-dibenzoyloxy-4-hydroxyoxolan-2-yl]methyl benzoate. InChIKey: HUHVPBKTTFVAQF-BILGYAHESA-N.
| Molecular formula | C26H22O8 |
|---|---|
| Molecular weight | 462.4 g/mol |
| IUPAC name | [(2R,3S,4R,5S)-3,5-dibenzoyloxy-4-hydroxyoxolan-2-yl]methyl benzoate |
| InChIKey | HUHVPBKTTFVAQF-BILGYAHESA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OC[C@@H]2[C@H]([C@H]([C@@H](O2)OC(=O)C3=CC=CC=C3)O)OC(=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)