CAS 67525-66-0 appears in our catalog under these names: (2R,3R,4R,5R)-2-((Benzoyloxy)methyl)-5-hydroxytetrahydrofuran-3,4-diyl dibenzoate, 95+%, 2,3,5-Tri-O-benzoyl-b-D-ribofuranose. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 500mg, 250mg, 1000mg, 5000mg, 2000mg.
[(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-hydroxyoxolan-2-yl]methyl benzoate (CAS 67525-66-0) is a chemical compound with the molecular formula C26H22O8 and a molecular weight of 462.4 g/mol. IUPAC name: [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-hydroxyoxolan-2-yl]methyl benzoate. InChIKey: VJYJDSXEIXFNRI-PIXQIBFHSA-N.
| Molecular formula | C26H22O8 |
|---|---|
| Molecular weight | 462.4 g/mol |
| IUPAC name | [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-hydroxyoxolan-2-yl]methyl benzoate |
| InChIKey | VJYJDSXEIXFNRI-PIXQIBFHSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OC[C@@H]2[C@H]([C@H]([C@@H](O2)O)OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)