CAS 1154598-26-1 appears in our catalog under these names: 6-(2,6-Difluorophenyl)-2,3-dihydropyridazin-3-one, 95%, 6-(2,6-Difluorophenyl)-2,3-dihydropyridazin-3-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
3-(2,6-difluorophenyl)-1H-pyridazin-6-one (CAS 1154598-26-1) is a chemical compound with the molecular formula C10H6F2N2O and a molecular weight of 208.16 g/mol. IUPAC name: 3-(2,6-difluorophenyl)-1H-pyridazin-6-one. InChIKey: POPWSWLVPINAOO-UHFFFAOYSA-N.
| Molecular formula | C10H6F2N2O |
|---|---|
| Molecular weight | 208.16 g/mol |
| IUPAC name | 3-(2,6-difluorophenyl)-1H-pyridazin-6-one |
| InChIKey | POPWSWLVPINAOO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C2=NNC(=O)C=C2)F |
Computed by PubChem (NCBI)