CAS 1340248-44-3 is the registry number for 2-(3,5-Difluorophenyl)-1H-imidazole-5-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3,5-difluorophenyl)-1H-imidazole-5-carbaldehyde (CAS 1340248-44-3) is a chemical compound with the molecular formula C10H6F2N2O and a molecular weight of 208.16 g/mol. IUPAC name: 2-(3,5-difluorophenyl)-1H-imidazole-5-carbaldehyde. InChIKey: KFQYWZNIYPFLOF-UHFFFAOYSA-N.
| Molecular formula | C10H6F2N2O |
|---|---|
| Molecular weight | 208.16 g/mol |
| IUPAC name | 2-(3,5-difluorophenyl)-1H-imidazole-5-carbaldehyde |
| InChIKey | KFQYWZNIYPFLOF-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1F)F)C2=NC=C(N2)C=O |
Computed by PubChem (NCBI)