CAS 875664-59-8 is the registry number for 3-(3,5-Difluorophenyl)-1h-pyrazole-4-carbaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
5-(3,5-difluorophenyl)-1H-pyrazole-4-carbaldehyde (CAS 875664-59-8) is a chemical compound with the molecular formula C10H6F2N2O and a molecular weight of 208.16 g/mol. IUPAC name: 5-(3,5-difluorophenyl)-1H-pyrazole-4-carbaldehyde. InChIKey: WYPNQEHRMYDLFU-UHFFFAOYSA-N.
| Molecular formula | C10H6F2N2O |
|---|---|
| Molecular weight | 208.16 g/mol |
| IUPAC name | 5-(3,5-difluorophenyl)-1H-pyrazole-4-carbaldehyde |
| InChIKey | WYPNQEHRMYDLFU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1F)F)C2=C(C=NN2)C=O |
Computed by PubChem (NCBI)