CAS 1154740-66-5 appears in our catalog under these names: 6-Bromo-5-chloro-2h-benzo[b][1,4]oxazin-3(4h)-one, 95%, 6-bromo-5-chloro-2h-benzo(b)(1,4)oxazin-3(4h)-one, 6-Bromo-5-chloro-2H-benzo[b][1,4]oxazin-3(4H)-one, 96%, 96%, 6-BROMO-5-CHLORO-2H-BENZO[B][1,4]OXAZIN-3(4H)-ONE, 96%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 2,5g, 100mg, 5g, 10g.
6-bromo-5-chloro-4H-1,4-benzoxazin-3-one (CAS 1154740-66-5) is a chemical compound with the molecular formula C8H5BrClNO2 and a molecular weight of 262.49 g/mol. IUPAC name: 6-bromo-5-chloro-4H-1,4-benzoxazin-3-one. InChIKey: DTSSBFUGQWFOHI-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClNO2 |
|---|---|
| Molecular weight | 262.49 g/mol |
| IUPAC name | 6-bromo-5-chloro-4H-1,4-benzoxazin-3-one |
| InChIKey | DTSSBFUGQWFOHI-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(O1)C=CC(=C2Cl)Br |
Computed by PubChem (NCBI)