CAS 880545-25-5 appears in our catalog under these names: 6-Bromo-7-chloro-2,4-dihydro-1,4-benzoxazin-3-one, 95%, 6-Bromo-7-chloro-2,4-dihydro-1,4-benzoxazin-3-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
6-bromo-7-chloro-4H-1,4-benzoxazin-3-one (CAS 880545-25-5) is a chemical compound with the molecular formula C8H5BrClNO2 and a molecular weight of 262.49 g/mol. IUPAC name: 6-bromo-7-chloro-4H-1,4-benzoxazin-3-one. InChIKey: GDWSWKKSEYXCQB-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClNO2 |
|---|---|
| Molecular weight | 262.49 g/mol |
| IUPAC name | 6-bromo-7-chloro-4H-1,4-benzoxazin-3-one |
| InChIKey | GDWSWKKSEYXCQB-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=CC(=C(C=C2O1)Cl)Br |
Computed by PubChem (NCBI)