CAS 2155876-24-5 appears in our catalog under these names: 8-Bromo-6-chloro-1,4-dihydro-2H-benzo[d][1,3]oxazin-2-one, 98%, Bromhexine Impurity 18. Offered by: Chemat Brand. Available pack sizes: on request.
8-bromo-6-chloro-1,4-dihydro-3,1-benzoxazin-2-one (CAS 2155876-24-5) is a chemical compound with the molecular formula C8H5BrClNO2 and a molecular weight of 262.49 g/mol. IUPAC name: 8-bromo-6-chloro-1,4-dihydro-3,1-benzoxazin-2-one. InChIKey: XSOZRNZVVYYLOH-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClNO2 |
|---|---|
| Molecular weight | 262.49 g/mol |
| IUPAC name | 8-bromo-6-chloro-1,4-dihydro-3,1-benzoxazin-2-one |
| InChIKey | XSOZRNZVVYYLOH-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=CC(=C2)Cl)Br)NC(=O)O1 |
Computed by PubChem (NCBI)