CAS 1154912-66-9 is the registry number for 6-Bromo-2,8-dimethyl-1,4-dihydroquinolin-4-one, 95%. Offered by: AmBeed. Available pack sizes: 5g.
6-bromo-2,8-dimethyl-1H-quinolin-4-one (CAS 1154912-66-9) is a chemical compound with the molecular formula C11H10BrNO and a molecular weight of 252.11 g/mol. IUPAC name: 6-bromo-2,8-dimethyl-1H-quinolin-4-one. InChIKey: SAFGGWQEMJBMKU-UHFFFAOYSA-N.
| Molecular formula | C11H10BrNO |
|---|---|
| Molecular weight | 252.11 g/mol |
| IUPAC name | 6-bromo-2,8-dimethyl-1H-quinolin-4-one |
| InChIKey | SAFGGWQEMJBMKU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1NC(=CC2=O)C)Br |
Computed by PubChem (NCBI)