CAS 1154944-02-1 appears in our catalog under these names: 2-(Bromomethyl)-4-nitro-1-(propan-2-yloxy)benzene, 95%, 2-(Bromomethyl)-4-nitro-1-(propan-2-yloxy)benzene. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
2-(bromomethyl)-4-nitro-1-propan-2-yloxybenzene (CAS 1154944-02-1) is a chemical compound with the molecular formula C10H12BrNO3 and a molecular weight of 274.11 g/mol. IUPAC name: 2-(bromomethyl)-4-nitro-1-propan-2-yloxybenzene. InChIKey: PTVGPAWJRQOLSR-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO3 |
|---|---|
| Molecular weight | 274.11 g/mol |
| IUPAC name | 2-(bromomethyl)-4-nitro-1-propan-2-yloxybenzene |
| InChIKey | PTVGPAWJRQOLSR-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=C(C=C1)[N+](=O)[O-])CBr |
Computed by PubChem (NCBI)