Products 115503-91-8

CAS 115503-91-8 is the registry number for AGN 190727. Offered by: MedChemExpress. Available pack sizes: Get quote.

Structural formula: {0} (CAS {1})

3-[(E)-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-1-ynyl]benzoic acid (CAS 115503-91-8) is a chemical compound with the molecular formula C20H22O2 and a molecular weight of 294.4 g/mol. IUPAC name: 3-[(E)-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-1-ynyl]benzoic acid. InChIKey: LIFPWEGANPHLQB-LFYBBSHMSA-N.

Identity
Molecular formulaC20H22O2
Molecular weight294.4 g/mol
IUPAC name3-[(E)-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-1-ynyl]benzoic acid
InChIKeyLIFPWEGANPHLQB-LFYBBSHMSA-N
SMILESCC1=C(C(CCC1)(C)C)/C=C/C#CC2=CC(=CC=C2)C(=O)O

Computed by PubChem (NCBI)