Products 1155071-55-8
CAS 1155071-55-8 appears in our catalog under these names: 2-(4-Formylphenoxymethyl)furan-3-carboxylic acid, 2-[(4-Formylphenoxy)methyl]furan-3-carboxylic Acid, >97%. Offered by: Biosynth, Chemat. Available pack sizes: 0,5g, 50mg, 250mg, 1g.
2-[(4-formylphenoxy)methyl]furan-3-carboxylic acid (CAS 1155071-55-8) is a chemical compound with the molecular formula C13H10O5 and a molecular weight of 246.21 g/mol. IUPAC name: 2-[(4-formylphenoxy)methyl]furan-3-carboxylic acid. InChIKey: LLPYZPOQHKWXFH-UHFFFAOYSA-N.
| Molecular formula | C13H10O5 |
|---|---|
| Molecular weight | 246.21 g/mol |
| IUPAC name | 2-[(4-formylphenoxy)methyl]furan-3-carboxylic acid |
| InChIKey | LLPYZPOQHKWXFH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)OCC2=C(C=CO2)C(=O)O |
Computed by PubChem (NCBI)