CAS 1155278-31-1 appears in our catalog under these names: 2-(3-(tert-Butyl)ureido)-3,3-dimethylbutanoic acid, 98%, N–((tert–Butylamino)carbonyl)–3–methylvaline. Offered by: AmBeed, GLPBio. Available pack sizes: 10g, 5g, 100mg, 1g, 250mg.
2-(tert-butylcarbamoylamino)-3,3-dimethylbutanoic acid (CAS 1155278-31-1) is a chemical compound with the molecular formula C11H22N2O3 and a molecular weight of 230.30 g/mol. IUPAC name: 2-(tert-butylcarbamoylamino)-3,3-dimethylbutanoic acid. InChIKey: RAAPXVRHYBAJQU-UHFFFAOYSA-N.
| Molecular formula | C11H22N2O3 |
|---|---|
| Molecular weight | 230.30 g/mol |
| IUPAC name | 2-(tert-butylcarbamoylamino)-3,3-dimethylbutanoic acid |
| InChIKey | RAAPXVRHYBAJQU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(C(=O)O)NC(=O)NC(C)(C)C |
Computed by PubChem (NCBI)