CAS 1187162-85-1 is the registry number for 3–Methyl–N–((2–methyl–2–propanyl)carbamoyl)–D–valine. Offered by: GLPBio. Available pack sizes: 100mg, 25mg.
2-(tert-butylcarbamoylamino)-3,3-dimethylbutanoic acid (CAS 1187162-85-1) is a chemical compound with the molecular formula C11H22N2O3 and a molecular weight of 230.30 g/mol. IUPAC name: 2-(tert-butylcarbamoylamino)-3,3-dimethylbutanoic acid. InChIKey: RAAPXVRHYBAJQU-UHFFFAOYSA-N.
| Molecular formula | C11H22N2O3 |
|---|---|
| Molecular weight | 230.30 g/mol |
| IUPAC name | 2-(tert-butylcarbamoylamino)-3,3-dimethylbutanoic acid |
| InChIKey | RAAPXVRHYBAJQU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(C(=O)O)NC(=O)NC(C)(C)C |
Computed by PubChem (NCBI)