CAS 115546-66-2 appears in our catalog under these names: Tazobactam Impurity C, Tazobactam Impurity 10. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(2S,3R,5R)-3-methyl-4,4,7-trioxo-3-(triazol-1-ylmethyl)-4lambda6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (CAS 115546-66-2) is a chemical compound with the molecular formula C10H12N4O5S and a molecular weight of 300.29 g/mol. IUPAC name: (2S,3R,5R)-3-methyl-4,4,7-trioxo-3-(triazol-1-ylmethyl)-4lambda6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid. InChIKey: LPQZKKCYTLCDGQ-KHQFGBGNSA-N.
| Molecular formula | C10H12N4O5S |
|---|---|
| Molecular weight | 300.29 g/mol |
| IUPAC name | (2S,3R,5R)-3-methyl-4,4,7-trioxo-3-(triazol-1-ylmethyl)-4lambda6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| InChIKey | LPQZKKCYTLCDGQ-KHQFGBGNSA-N |
| SMILES | C[C@]1([C@@H](N2[C@H](S1(=O)=O)CC2=O)C(=O)O)CN3C=CN=N3 |
Computed by PubChem (NCBI)