Products 2666934-59-2
CAS 2666934-59-2 appears in our catalog under these names: Carbazochrome Impurity 11, Carbazochrome Impurity 16. Offered by: Chemat Brand. Available pack sizes: on request.
5-(2-carbamoylhydrazinyl)-1-methyl-6-oxo-2H-indole-2-sulfonic acid (CAS 2666934-59-2) is a chemical compound with the molecular formula C10H12N4O5S and a molecular weight of 300.29 g/mol. IUPAC name: 5-(2-carbamoylhydrazinyl)-1-methyl-6-oxo-2H-indole-2-sulfonic acid. InChIKey: RAJWFNVXMDTIBI-UHFFFAOYSA-N.
| Molecular formula | C10H12N4O5S |
|---|---|
| Molecular weight | 300.29 g/mol |
| IUPAC name | 5-(2-carbamoylhydrazinyl)-1-methyl-6-oxo-2H-indole-2-sulfonic acid |
| InChIKey | RAJWFNVXMDTIBI-UHFFFAOYSA-N |
| SMILES | CN1C(C=C2C1=CC(=O)C(=C2)NNC(=O)N)S(=O)(=O)O |
Computed by PubChem (NCBI)