Products 24386-76-3
CAS 24386-76-3 is the registry number for 6-Thioxanthosine. Offered by: TRC. Available pack sizes: 2,5g.
9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-sulfanylidene-3H-purin-2-one (CAS 24386-76-3) is a chemical compound with the molecular formula C10H12N4O5S and a molecular weight of 300.29 g/mol. IUPAC name: 9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-sulfanylidene-3H-purin-2-one. InChIKey: NWYWQXDBECLBTR-UHFFFAOYSA-N.
| Molecular formula | C10H12N4O5S |
|---|---|
| Molecular weight | 300.29 g/mol |
| IUPAC name | 9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-sulfanylidene-3H-purin-2-one |
| InChIKey | NWYWQXDBECLBTR-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(N1C3C(C(C(O3)CO)O)O)NC(=O)NC2=S |
Computed by PubChem (NCBI)