Products 1155460-43-7

CAS 1155460-43-7 is the registry number for 1-(2-Fluorophenyl)-5-propyl-1H-1,2,4-triazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

1-(2-fluorophenyl)-5-propyl-1,2,4-triazole-3-carboxylic acid (CAS 1155460-43-7) is a chemical compound with the molecular formula C12H12FN3O2 and a molecular weight of 249.24 g/mol. IUPAC name: 1-(2-fluorophenyl)-5-propyl-1,2,4-triazole-3-carboxylic acid. InChIKey: YUZVZTHGYJRXBT-UHFFFAOYSA-N.

Identity
Molecular formulaC12H12FN3O2
Molecular weight249.24 g/mol
IUPAC name1-(2-fluorophenyl)-5-propyl-1,2,4-triazole-3-carboxylic acid
InChIKeyYUZVZTHGYJRXBT-UHFFFAOYSA-N
SMILESCCCC1=NC(=NN1C2=CC=CC=C2F)C(=O)O

Computed by PubChem (NCBI)