CAS 115549-13-8 is the registry number for 3-Amino-2,4-dichloro-5-fluorobenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-amino-2,4-dichloro-5-fluorobenzoic acid (CAS 115549-13-8) is a chemical compound with the molecular formula C7H4Cl2FNO2 and a molecular weight of 224.01 g/mol. IUPAC name: 3-amino-2,4-dichloro-5-fluorobenzoic acid. InChIKey: UUWRGHXQVQUWHR-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2FNO2 |
|---|---|
| Molecular weight | 224.01 g/mol |
| IUPAC name | 3-amino-2,4-dichloro-5-fluorobenzoic acid |
| InChIKey | UUWRGHXQVQUWHR-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)Cl)N)Cl)C(=O)O |
Computed by PubChem (NCBI)