Products 115549-13-8

CAS 115549-13-8 is the registry number for 3-Amino-2,4-dichloro-5-fluorobenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

3-amino-2,4-dichloro-5-fluorobenzoic acid (CAS 115549-13-8) is a chemical compound with the molecular formula C7H4Cl2FNO2 and a molecular weight of 224.01 g/mol. IUPAC name: 3-amino-2,4-dichloro-5-fluorobenzoic acid. InChIKey: UUWRGHXQVQUWHR-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4Cl2FNO2
Molecular weight224.01 g/mol
IUPAC name3-amino-2,4-dichloro-5-fluorobenzoic acid
InChIKeyUUWRGHXQVQUWHR-UHFFFAOYSA-N
SMILESC1=C(C(=C(C(=C1F)Cl)N)Cl)C(=O)O

Computed by PubChem (NCBI)