Products 2226291-03-6
CAS 2226291-03-6 appears in our catalog under these names: Methyl 2,6-dichloro-3-fluoroisonicotinate, 98%, 98%, Methyl 2,6-dichloro-3-fluoroisonicotinate, 98%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
Methyl 2,6-dichloro-3-fluoropyridine-4-carboxylate (CAS 2226291-03-6) is a chemical compound with the molecular formula C7H4Cl2FNO2 and a molecular weight of 224.01 g/mol. IUPAC name: methyl 2,6-dichloro-3-fluoropyridine-4-carboxylate. InChIKey: VYPIIAGMVCOVMV-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2FNO2 |
|---|---|
| Molecular weight | 224.01 g/mol |
| IUPAC name | methyl 2,6-dichloro-3-fluoropyridine-4-carboxylate |
| InChIKey | VYPIIAGMVCOVMV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=NC(=C1F)Cl)Cl |
Computed by PubChem (NCBI)