CAS 132195-42-7 appears in our catalog under these names: 2,6-Dichloro-5-fluoro-4-methylpyridine-3-carboxylic acid, 95%, 2,6–Dichloro–5–fluoro–4–methylnicotinic acid, 2,6-Dichloro-5-fluoro-4-methylnicotinic acid 95%. Offered by: Combi-blocks, GLPBio, Ambeed. Available pack sizes: 250mg, 5g, 1g, 100mg, 50mg.
2,6-dichloro-5-fluoro-4-methylpyridine-3-carboxylic acid (CAS 132195-42-7) is a chemical compound with the molecular formula C7H4Cl2FNO2 and a molecular weight of 224.01 g/mol. IUPAC name: 2,6-dichloro-5-fluoro-4-methylpyridine-3-carboxylic acid. InChIKey: CACZOIOUVVFGLV-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2FNO2 |
|---|---|
| Molecular weight | 224.01 g/mol |
| IUPAC name | 2,6-dichloro-5-fluoro-4-methylpyridine-3-carboxylic acid |
| InChIKey | CACZOIOUVVFGLV-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC(=C1F)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)