CAS 1155522-11-4 is the registry number for 3-(5-(Difluoromethyl)-1,2,4-oxadiazol-3-yl)aniline, 95%. Offered by: AmBeed. Available pack sizes: 1g.
3-[5-(difluoromethyl)-1,2,4-oxadiazol-3-yl]aniline (CAS 1155522-11-4) is a chemical compound with the molecular formula C9H7F2N3O and a molecular weight of 211.17 g/mol. IUPAC name: 3-[5-(difluoromethyl)-1,2,4-oxadiazol-3-yl]aniline. InChIKey: LQEGRVSPFYNYAU-UHFFFAOYSA-N.
| Molecular formula | C9H7F2N3O |
|---|---|
| Molecular weight | 211.17 g/mol |
| IUPAC name | 3-[5-(difluoromethyl)-1,2,4-oxadiazol-3-yl]aniline |
| InChIKey | LQEGRVSPFYNYAU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C2=NOC(=N2)C(F)F |
Computed by PubChem (NCBI)