CAS 1250500-78-7 appears in our catalog under these names: 5-Amino-1-(2,4-difluorophenyl)-1H-pyrazol-3-ol, 95%, 5-Amino-1-(2,4-difluorophenyl)-1H-pyrazol-3-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
3-amino-2-(2,4-difluorophenyl)-1H-pyrazol-5-one (CAS 1250500-78-7) is a chemical compound with the molecular formula C9H7F2N3O and a molecular weight of 211.17 g/mol. IUPAC name: 3-amino-2-(2,4-difluorophenyl)-1H-pyrazol-5-one. InChIKey: WWKJCZGAJNIIMU-UHFFFAOYSA-N.
| Molecular formula | C9H7F2N3O |
|---|---|
| Molecular weight | 211.17 g/mol |
| IUPAC name | 3-amino-2-(2,4-difluorophenyl)-1H-pyrazol-5-one |
| InChIKey | WWKJCZGAJNIIMU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)N2C(=CC(=O)N2)N |
Computed by PubChem (NCBI)