CAS 1512408-08-0 appears in our catalog under these names: 5-((2,4-Difluorophenyl)methyl)-1,2,4-oxadiazol-3-amine, 95%, 5-((2,4-Difluorophenyl)methyl)-1,2,4-oxadiazol-3-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-[(2,4-difluorophenyl)methyl]-1,2,4-oxadiazol-3-amine (CAS 1512408-08-0) is a chemical compound with the molecular formula C9H7F2N3O and a molecular weight of 211.17 g/mol. IUPAC name: 5-[(2,4-difluorophenyl)methyl]-1,2,4-oxadiazol-3-amine. InChIKey: BPAKKPGGEYDIJW-UHFFFAOYSA-N.
| Molecular formula | C9H7F2N3O |
|---|---|
| Molecular weight | 211.17 g/mol |
| IUPAC name | 5-[(2,4-difluorophenyl)methyl]-1,2,4-oxadiazol-3-amine |
| InChIKey | BPAKKPGGEYDIJW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)CC2=NC(=NO2)N |
Computed by PubChem (NCBI)