Products 1155567-20-6
CAS 1155567-20-6 is the registry number for 2-{(4-(Methylsulfamoyl)phenyl)sulfanyl}benzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[4-(methylsulfamoyl)phenyl]sulfanylbenzoic acid (CAS 1155567-20-6) is a chemical compound with the molecular formula C14H13NO4S2 and a molecular weight of 323.4 g/mol. IUPAC name: 2-[4-(methylsulfamoyl)phenyl]sulfanylbenzoic acid. InChIKey: IBXQINPTFCSBHA-UHFFFAOYSA-N.
| Molecular formula | C14H13NO4S2 |
|---|---|
| Molecular weight | 323.4 g/mol |
| IUPAC name | 2-[4-(methylsulfamoyl)phenyl]sulfanylbenzoic acid |
| InChIKey | IBXQINPTFCSBHA-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)C1=CC=C(C=C1)SC2=CC=CC=C2C(=O)O |
Computed by PubChem (NCBI)