CAS 924062-42-0 is the registry number for 5-(1,2,3,4-Tetrahydroisoquinoline-2-sulfonyl)thiophene-3-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
5-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)thiophene-3-carboxylic acid (CAS 924062-42-0) is a chemical compound with the molecular formula C14H13NO4S2 and a molecular weight of 323.4 g/mol. IUPAC name: 5-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)thiophene-3-carboxylic acid. InChIKey: XYCHCSLSTDVJRY-UHFFFAOYSA-N.
| Molecular formula | C14H13NO4S2 |
|---|---|
| Molecular weight | 323.4 g/mol |
| IUPAC name | 5-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)thiophene-3-carboxylic acid |
| InChIKey | XYCHCSLSTDVJRY-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=CC=CC=C21)S(=O)(=O)C3=CC(=CS3)C(=O)O |
Computed by PubChem (NCBI)