CAS 924116-79-0 appears in our catalog under these names: 3-(3,4-Dihydroisoquinolin-2(1h)-ylsulfonyl)thiophene-2-carboxylic acid, 95%, 3-(1,2,3,4-Tetrahydroisoquinoline-2-sulfonyl)thiophene-2-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)thiophene-2-carboxylic acid (CAS 924116-79-0) is a chemical compound with the molecular formula C14H13NO4S2 and a molecular weight of 323.4 g/mol. IUPAC name: 3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)thiophene-2-carboxylic acid. InChIKey: DTKJYYPJXFMPGE-UHFFFAOYSA-N.
| Molecular formula | C14H13NO4S2 |
|---|---|
| Molecular weight | 323.4 g/mol |
| IUPAC name | 3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)thiophene-2-carboxylic acid |
| InChIKey | DTKJYYPJXFMPGE-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=CC=CC=C21)S(=O)(=O)C3=C(SC=C3)C(=O)O |
Computed by PubChem (NCBI)