Products 1155909-82-2
CAS 1155909-82-2 is the registry number for 2-Methyl-4-((4-methyl-1,3-thiazol-2-yl)sulfanyl)aniline. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
2-methyl-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]aniline (CAS 1155909-82-2) is a chemical compound with the molecular formula C11H12N2S2 and a molecular weight of 236.4 g/mol. IUPAC name: 2-methyl-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]aniline. InChIKey: KIGOAFGNFGUNGG-UHFFFAOYSA-N.
| Molecular formula | C11H12N2S2 |
|---|---|
| Molecular weight | 236.4 g/mol |
| IUPAC name | 2-methyl-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]aniline |
| InChIKey | KIGOAFGNFGUNGG-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)SC2=NC(=CS2)C)N |
Computed by PubChem (NCBI)