CAS 1432682-07-9 appears in our catalog under these names: 2-Methyl-4-{4H,5H,6H,7H-thieno(3,2-c)pyridin-2-yl}-1,3-thiazole, 95%, 2-Methyl-4-{4H,5H,6H,7H-thieno(3,2-c)pyridin-2-yl}-1,3-thiazole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-(2-methyl-1,3-thiazol-4-yl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine (CAS 1432682-07-9) is a chemical compound with the molecular formula C11H12N2S2 and a molecular weight of 236.4 g/mol. IUPAC name: 2-(2-methyl-1,3-thiazol-4-yl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine. InChIKey: CKJIXPZEBBPLQB-UHFFFAOYSA-N.
| Molecular formula | C11H12N2S2 |
|---|---|
| Molecular weight | 236.4 g/mol |
| IUPAC name | 2-(2-methyl-1,3-thiazol-4-yl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine |
| InChIKey | CKJIXPZEBBPLQB-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CS1)C2=CC3=C(S2)CCNC3 |
Computed by PubChem (NCBI)