CAS 314260-78-1 is the registry number for 7-Methyl-5,6,7,8-tetrahydro-benzo[4,5]thieno[2,3-d]pyrimidine-4-thiol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
7-methyl-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidine-4-thione (CAS 314260-78-1) is a chemical compound with the molecular formula C11H12N2S2 and a molecular weight of 236.4 g/mol. IUPAC name: 7-methyl-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidine-4-thione. InChIKey: RBWNDBNSJFCLBZ-UHFFFAOYSA-N.
| Molecular formula | C11H12N2S2 |
|---|---|
| Molecular weight | 236.4 g/mol |
| IUPAC name | 7-methyl-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidine-4-thione |
| InChIKey | RBWNDBNSJFCLBZ-UHFFFAOYSA-N |
| SMILES | CC1CCC2=C(C1)SC3=C2C(=S)NC=N3 |
Computed by PubChem (NCBI)