Products 115615-20-8
CAS 115615-20-8 appears in our catalog under these names: 1-BROMO-2-(BROMOMETHYL)-3,5-DICHLORO-BENZENE, 98%, 1-Bromo-2-(Bromomethyl)-3,5-Dichlorobenzene, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-bromo-2-(bromomethyl)-3,5-dichlorobenzene (CAS 115615-20-8) is a chemical compound with the molecular formula C7H4Br2Cl2 and a molecular weight of 318.82 g/mol. IUPAC name: 1-bromo-2-(bromomethyl)-3,5-dichlorobenzene. InChIKey: OZCNEACBSLUSER-UHFFFAOYSA-N.
| Molecular formula | C7H4Br2Cl2 |
|---|---|
| Molecular weight | 318.82 g/mol |
| IUPAC name | 1-bromo-2-(bromomethyl)-3,5-dichlorobenzene |
| InChIKey | OZCNEACBSLUSER-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)CBr)Br)Cl |
Computed by PubChem (NCBI)