CAS 951884-87-0 is the registry number for 3,6-Dibromo-2,4-dichlorotoluene, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1,4-dibromo-3,5-dichloro-2-methylbenzene (CAS 951884-87-0) is a chemical compound with the molecular formula C7H4Br2Cl2 and a molecular weight of 318.82 g/mol. IUPAC name: 1,4-dibromo-3,5-dichloro-2-methylbenzene. InChIKey: XMCAVTKZXXWDEJ-UHFFFAOYSA-N.
| Molecular formula | C7H4Br2Cl2 |
|---|---|
| Molecular weight | 318.82 g/mol |
| IUPAC name | 1,4-dibromo-3,5-dichloro-2-methylbenzene |
| InChIKey | XMCAVTKZXXWDEJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C(=C1Cl)Br)Cl)Br |
Computed by PubChem (NCBI)