Products 274671-76-0
CAS 274671-76-0 is the registry number for 5-BROMO-2-(BROMOMETHYL)-1,3-DICHLOROBENZENE, >95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
5-bromo-2-(bromomethyl)-1,3-dichlorobenzene (CAS 274671-76-0) is a chemical compound with the molecular formula C7H4Br2Cl2 and a molecular weight of 318.82 g/mol. IUPAC name: 5-bromo-2-(bromomethyl)-1,3-dichlorobenzene. InChIKey: FDWFIQWULNKHOP-UHFFFAOYSA-N.
| Molecular formula | C7H4Br2Cl2 |
|---|---|
| Molecular weight | 318.82 g/mol |
| IUPAC name | 5-bromo-2-(bromomethyl)-1,3-dichlorobenzene |
| InChIKey | FDWFIQWULNKHOP-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)CBr)Cl)Br |
Computed by PubChem (NCBI)