CAS 115661-18-2 appears in our catalog under these names: 3,4–Dichloro–2–hydroxybenzonitrile, 3,4-Dichloro-2-hydroxybenzonitrile 95%, 3,4-Dichloro-2-hydroxybenzonitrile, 95%, 3,4-Dichloro-2-hydroxybenzonitrile, 95%, 95%. Offered by: GLPBio, Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
3,4-dichloro-2-hydroxybenzonitrile (CAS 115661-18-2) is a chemical compound with the molecular formula C7H3Cl2NO and a molecular weight of 188.01 g/mol. IUPAC name: 3,4-dichloro-2-hydroxybenzonitrile. InChIKey: PKURWWNWSLXZHM-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2NO |
|---|---|
| Molecular weight | 188.01 g/mol |
| IUPAC name | 3,4-dichloro-2-hydroxybenzonitrile |
| InChIKey | PKURWWNWSLXZHM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C#N)O)Cl)Cl |
Computed by PubChem (NCBI)