CAS 1156755-81-5 is the registry number for N-(3,5-Difluorophenyl)prop-2-enamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
N-(3,5-difluorophenyl)prop-2-enamide (CAS 1156755-81-5) is a chemical compound with the molecular formula C9H7F2NO and a molecular weight of 183.15 g/mol. IUPAC name: N-(3,5-difluorophenyl)prop-2-enamide. InChIKey: GEWSUIBJGONZMO-UHFFFAOYSA-N.
| Molecular formula | C9H7F2NO |
|---|---|
| Molecular weight | 183.15 g/mol |
| IUPAC name | N-(3,5-difluorophenyl)prop-2-enamide |
| InChIKey | GEWSUIBJGONZMO-UHFFFAOYSA-N |
| SMILES | C=CC(=O)NC1=CC(=CC(=C1)F)F |
Computed by PubChem (NCBI)