Products 1156838-26-4

CAS 1156838-26-4 is the registry number for 2-Amino-6-bromo-3-methylbenzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-amino-6-bromo-3-methylbenzoic acid (CAS 1156838-26-4) is a chemical compound with the molecular formula C8H8BrNO2 and a molecular weight of 230.06 g/mol. IUPAC name: 2-amino-6-bromo-3-methylbenzoic acid. InChIKey: CFYMUCDDZDMONG-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8BrNO2
Molecular weight230.06 g/mol
IUPAC name2-amino-6-bromo-3-methylbenzoic acid
InChIKeyCFYMUCDDZDMONG-UHFFFAOYSA-N
SMILESCC1=C(C(=C(C=C1)Br)C(=O)O)N

Computed by PubChem (NCBI)