CAS 1156842-50-0 appears in our catalog under these names: 1–(4–Bromo–2–methylbenzoyl)piperazine, 1-(4-Bromo-2-methylbenzoyl)piperazine. Offered by: GLPBio, Biosynth. Available pack sizes: 100mg, 25mg, 1g.
(4-bromo-2-methylphenyl)-piperazin-1-ylmethanone (CAS 1156842-50-0) is a chemical compound with the molecular formula C12H15BrN2O and a molecular weight of 283.16 g/mol. IUPAC name: (4-bromo-2-methylphenyl)-piperazin-1-ylmethanone. InChIKey: JPPPZQWQOYPLMW-UHFFFAOYSA-N.
| Molecular formula | C12H15BrN2O |
|---|---|
| Molecular weight | 283.16 g/mol |
| IUPAC name | (4-bromo-2-methylphenyl)-piperazin-1-ylmethanone |
| InChIKey | JPPPZQWQOYPLMW-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Br)C(=O)N2CCNCC2 |
Computed by PubChem (NCBI)