Products 1156989-90-0
CAS 1156989-90-0 is the registry number for 5-Bromo-7-chloro-2,3-dihydrobenzofuran-3-amine, 95%. Offered by: BLDpharm. Available pack sizes: 1g.
5-bromo-7-chloro-2,3-dihydro-1-benzofuran-3-amine (CAS 1156989-90-0) is a chemical compound with the molecular formula C8H7BrClNO and a molecular weight of 248.50 g/mol. IUPAC name: 5-bromo-7-chloro-2,3-dihydro-1-benzofuran-3-amine. InChIKey: AZRSAUCDYTWXQC-UHFFFAOYSA-N.
| Molecular formula | C8H7BrClNO |
|---|---|
| Molecular weight | 248.50 g/mol |
| IUPAC name | 5-bromo-7-chloro-2,3-dihydro-1-benzofuran-3-amine |
| InChIKey | AZRSAUCDYTWXQC-UHFFFAOYSA-N |
| SMILES | C1C(C2=C(O1)C(=CC(=C2)Br)Cl)N |
Computed by PubChem (NCBI)