CAS 115728-96-6 is the registry number for Z-Thr-nh2, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 100g, 25g, 5g.
Benzyl N-[(2S,3R)-1-amino-3-hydroxy-1-oxobutan-2-yl]carbamate (CAS 115728-96-6) is a chemical compound with the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. IUPAC name: benzyl N-[(2S,3R)-1-amino-3-hydroxy-1-oxobutan-2-yl]carbamate. InChIKey: PYZXYZOBPGPOFQ-SCZZXKLOSA-N.
| Molecular formula | C12H16N2O4 |
|---|---|
| Molecular weight | 252.27 g/mol |
| IUPAC name | benzyl N-[(2S,3R)-1-amino-3-hydroxy-1-oxobutan-2-yl]carbamate |
| InChIKey | PYZXYZOBPGPOFQ-SCZZXKLOSA-N |
| SMILES | C[C@H]([C@@H](C(=O)N)NC(=O)OCC1=CC=CC=C1)O |
Computed by PubChem (NCBI)