Products 115728-96-6

CAS 115728-96-6 is the registry number for Z-Thr-nh2, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 100g, 25g, 5g.

Structural formula: {0} (CAS {1})

Benzyl N-[(2S,3R)-1-amino-3-hydroxy-1-oxobutan-2-yl]carbamate (CAS 115728-96-6) is a chemical compound with the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. IUPAC name: benzyl N-[(2S,3R)-1-amino-3-hydroxy-1-oxobutan-2-yl]carbamate. InChIKey: PYZXYZOBPGPOFQ-SCZZXKLOSA-N.

Identity
Molecular formulaC12H16N2O4
Molecular weight252.27 g/mol
IUPAC namebenzyl N-[(2S,3R)-1-amino-3-hydroxy-1-oxobutan-2-yl]carbamate
InChIKeyPYZXYZOBPGPOFQ-SCZZXKLOSA-N
SMILESC[C@H]([C@@H](C(=O)N)NC(=O)OCC1=CC=CC=C1)O

Computed by PubChem (NCBI)