CAS 1157379-85-5 appears in our catalog under these names: (2-(3-(Methylsulfonyl)phenoxy)pyridin-3-yl)methanamine, 98%, (2-(3-Methanesulfonylphenoxy)pyridin-3-yl)methanamine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
[2-(3-methylsulfonylphenoxy)-3-pyridinyl]methanamine (CAS 1157379-85-5) is a chemical compound with the molecular formula C13H14N2O3S and a molecular weight of 278.33 g/mol. IUPAC name: [2-(3-methylsulfonylphenoxy)-3-pyridinyl]methanamine. InChIKey: SZLPAGGXVKZWNX-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O3S |
|---|---|
| Molecular weight | 278.33 g/mol |
| IUPAC name | [2-(3-methylsulfonylphenoxy)-3-pyridinyl]methanamine |
| InChIKey | SZLPAGGXVKZWNX-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=CC(=C1)OC2=C(C=CC=N2)CN |
Computed by PubChem (NCBI)