CAS 1157562-31-6 is the registry number for 2-(4-(Trifluoromethoxy)phenyl)cyclopropane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[4-(trifluoromethoxy)phenyl]cyclopropane-1-carboxylic acid (CAS 1157562-31-6) is a chemical compound with the molecular formula C11H9F3O3 and a molecular weight of 246.18 g/mol. IUPAC name: 2-[4-(trifluoromethoxy)phenyl]cyclopropane-1-carboxylic acid. InChIKey: IYYOCNQIQCLRHF-UHFFFAOYSA-N.
| Molecular formula | C11H9F3O3 |
|---|---|
| Molecular weight | 246.18 g/mol |
| IUPAC name | 2-[4-(trifluoromethoxy)phenyl]cyclopropane-1-carboxylic acid |
| InChIKey | IYYOCNQIQCLRHF-UHFFFAOYSA-N |
| SMILES | C1C(C1C(=O)O)C2=CC=C(C=C2)OC(F)(F)F |
Computed by PubChem (NCBI)